C23H30N6O — CID 58015854
7-cyclopentyl-5,5-dimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58015854) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 7-cyclopentyl-5,5-dimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 7-cyclopentyl-5,5-dimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 58015854 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 7-cyclopentyl-5,5-dimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)N(C2CCCC2)c2nc(Nc3ccc(N4CCNCC4)cc3)ncc21 |
| InChI | InChI=1S/C23H30N6O/c1-23(2)19-15-25-22(27-20(19)29(21(23)30)18-5-3-4-6-18)26-16-7-9-17(10-8-16)28-13-11-24-12-14-28/h7-10,15,18,24H,3-6,11-14H2,1-2H3,(H,25,26,27) |
| InChIKey | QTHGFKIFWQPXGO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|