C24H31N7O — CID 58015961
7-cyclopentyl-N,N-dimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 58015961) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is 7-cyclopentyl-N,N-dimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 7-cyclopentyl-N,N-dimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 58015961 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 7-cyclopentyl-N,N-dimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cnc(Nc3ccc(N4CCNCC4)cc3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C24H31N7O/c1-29(2)23(32)21-15-17-16-26-24(28-22(17)31(21)20-5-3-4-6-20)27-18-7-9-19(10-8-18)30-13-11-25-12-14-30/h7-10,15-16,20,25H,3-6,11-14H2,1-2H3,(H,26,27,28) |
| InChIKey | GIEZCFPNBLPSOM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|