C28H25ClN4O2S — CID 58016741
1-[(3-chlorophenyl)methyl]-3-naphthalen-1-ylsulfonyl-5-piperazin-1-ylindazole (PubChem CID 58016741) has the molecular formula C28H25ClN4O2S and a molecular weight of 517.05 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-naphthalen-1-ylsulfonyl-5-piperazin-1-ylindazole.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-naphthalen-1-ylsulfonyl-5-piperazin-1-ylindazole |
|---|---|
| PubChem CID | 58016741 |
| Molecular Formula | C28H25ClN4O2S |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-naphthalen-1-ylsulfonyl-5-piperazin-1-ylindazole |
| SMILES | O=S(=O)(c1cccc2ccccc12)c1nn(Cc2cccc(Cl)c2)c2ccc(N3CCNCC3)cc12 |
| InChI | InChI=1S/C28H25ClN4O2S/c29-22-8-3-5-20(17-22)19-33-26-12-11-23(32-15-13-30-14-16-32)18-25(26)28(31-33)36(34,35)27-10-4-7-21-6-1-2-9-24(21)27/h1-12,17-18,30H,13-16,19H2 |
| InChIKey | GIUKTVYWPWHWKX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |