C27H27N3O4 — CID 58016797
6-[[6-(2-ethenylphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid (PubChem CID 58016797) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 6-[[6-(2-ethenylphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid.
| Compound Name | 6-[[6-(2-ethenylphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 58016797 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 6-[[6-(2-ethenylphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid |
| SMILES | C=Cc1ccccc1-c1oc2ncnc(NCCCCCC(=O)O)c2c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-3-18-9-6-7-10-21(18)25-23(19-12-14-20(33-2)15-13-19)24-26(29-17-30-27(24)34-25)28-16-8-4-5-11-22(31)32/h3,6-7,9-10,12-15,17H,1,4-5,8,11,16H2,2H3,(H,31,32)(H,28,29,30) |
| InChIKey | NTXZRCJVSMFPJV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|