C17H12ClN3O3 — CID 58017128
3'-benzyl-5-chlorospiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione (PubChem CID 58017128) has the molecular formula C17H12ClN3O3 and a molecular weight of 341.75 g/mol. Its IUPAC name is 3'-benzyl-5-chlorospiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione.
| Compound Name | 3'-benzyl-5-chlorospiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione |
|---|---|
| PubChem CID | 58017128 |
| Molecular Formula | C17H12ClN3O3 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3'-benzyl-5-chlorospiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione |
| SMILES | O=C1NC2(C(=O)Nc3ccc(Cl)cc32)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H12ClN3O3/c18-11-6-7-13-12(8-11)17(14(22)19-13)15(23)21(16(24)20-17)9-10-4-2-1-3-5-10/h1-8H,9H2,(H,19,22)(H,20,24) |
| InChIKey | YRNIOZGUVNYJIR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|