About [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid
[2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid (PubChem CID 58017275) has the molecular formula C15H21BCl2FNO2
and a molecular weight of 348.05 g/mol. Its IUPAC name is [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid.
Molecular Properties
| Compound Name | [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid |
| PubChem CID | 58017275 |
| Molecular Formula | C15H21BCl2FNO2 |
| Molecular Weight | 348.05 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid |
| SMILES | CCCC1(C(O)c2cc(F)c(Cl)c(Cl)c2)CCCN1B(C)O |
| InChI | InChI=1S/C15H21BCl2FNO2/c1-3-5-15(6-4-7-20(15)16(2)22)14(21)10-8-11(17)13(18)12(19)9-10/h8-9,14,21-22H,3-7H2,1-2H3 |
| InChIKey | ORYUQHUTUAEEFD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.05 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid?
The IUPAC name of [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid (CID 58017275) is [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid.
What is the SMILES notation for [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid?
The canonical SMILES for [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid is CCCC1(C(O)c2cc(F)c(Cl)c(Cl)c2)CCCN1B(C)O.
What is the InChIKey of [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid?
The InChIKey is ORYUQHUTUAEEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BCl2FNO2/c1-3-5-15(6-4-7-20(15)16(2)22)14(21)10-8-11(17)13(18)12(19)9-10/h8-9,14,21-22H,3-7H2,1-2H3.
What are the key properties of [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid?
[2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid has a molecular weight of 348.05 g/mol, XLogP of 3.91, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidin-1-yl]-methylborinic acid is sourced from PubChem (CID 58017275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).