About 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate
8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate (PubChem CID 58017291) has the molecular formula C14H21NO5
and a molecular weight of 283.32 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate.
Molecular Properties
| Compound Name | 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate |
| PubChem CID | 58017291 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate |
| SMILES | COC(=O)C1=C(O)CC2CCC1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21NO5/c1-14(2,3)20-13(18)15-8-5-6-9(15)11(10(16)7-8)12(17)19-4/h8-9,16H,5-7H2,1-4H3 |
| InChIKey | CILKQBGPSRRHQR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate?
The IUPAC name of 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate (CID 58017291) is 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate.
What is the SMILES notation for 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate?
The canonical SMILES for 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate is COC(=O)C1=C(O)CC2CCC1N2C(=O)OC(C)(C)C.
What is the InChIKey of 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate?
The InChIKey is CILKQBGPSRRHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO5/c1-14(2,3)20-13(18)15-8-5-6-9(15)11(10(16)7-8)12(17)19-4/h8-9,16H,5-7H2,1-4H3.
What are the key properties of 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate?
8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate has a molecular weight of 283.32 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-O-tert-butyl 2-O-methyl 3-hydroxy-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate is sourced from PubChem (CID 58017291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).