About 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione
3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione (PubChem CID 58017810) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione.
Molecular Properties
| Compound Name | 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione |
| PubChem CID | 58017810 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione |
| SMILES | CC1=CC2(CCC(=O)O2)C2OC2C1=O |
| InChI | InChI=1S/C10H10O4/c1-5-4-10(3-2-6(11)14-10)9-8(13-9)7(5)12/h4,8-9H,2-3H2,1H3 |
| InChIKey | HSDFRPWISBXJFR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione?
The IUPAC name of 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione (CID 58017810) is 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione.
What is the SMILES notation for 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione?
The canonical SMILES for 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione is CC1=CC2(CCC(=O)O2)C2OC2C1=O.
What is the InChIKey of 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione?
The InChIKey is HSDFRPWISBXJFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c1-5-4-10(3-2-6(11)14-10)9-8(13-9)7(5)12/h4,8-9H,2-3H2,1H3.
What are the key properties of 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione?
3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione has a molecular weight of 194.19 g/mol, XLogP of 0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione is sourced from PubChem (CID 58017810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).