C11H12O4 — CID 58017814
(3'R,5R)-3,3'-dimethylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione (PubChem CID 58017814) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (3'R,5R)-3,3'-dimethylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione.
| Compound Name | (3'R,5R)-3,3'-dimethylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 58017814 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (3'R,5R)-3,3'-dimethylspiro[7-oxabicyclo[4.1.0]hept-3-ene-5,5'-oxolane]-2,2'-dione |
| SMILES | CC1=C[C@]2(C[C@@H](C)C(=O)O2)C2OC2C1=O |
| InChI | InChI=1S/C11H12O4/c1-5-3-11(4-6(2)10(13)15-11)9-8(14-9)7(5)12/h3,6,8-9H,4H2,1-2H3/t6-,8?,9?,11+/m1/s1 |
| InChIKey | SKEUZURDAVQQFY-WFYCCFHSSA-N |
| XLogP | 0.60 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|