About (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate
(1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate (PubChem CID 58018309) has the molecular formula C22H23N3O2
and a molecular weight of 361.45 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate.
Molecular Properties
| Compound Name | (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate |
| PubChem CID | 58018309 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate |
| SMILES | O=C(Nc1cccc2cnccc12)OC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H23N3O2/c26-22(24-21-8-4-7-18-15-23-12-9-20(18)21)27-19-10-13-25(14-11-19)16-17-5-2-1-3-6-17/h1-9,12,15,19H,10-11,13-14,16H2,(H,24,26) |
| InChIKey | ILPHGKLSHUNZFR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate?
The IUPAC name of (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate (CID 58018309) is (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate.
What is the SMILES notation for (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate?
The canonical SMILES for (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate is O=C(Nc1cccc2cnccc12)OC1CCN(Cc2ccccc2)CC1.
What is the InChIKey of (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate?
The InChIKey is ILPHGKLSHUNZFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O2/c26-22(24-21-8-4-7-18-15-23-12-9-20(18)21)27-19-10-13-25(14-11-19)16-17-5-2-1-3-6-17/h1-9,12,15,19H,10-11,13-14,16H2,(H,24,26).
What are the key properties of (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate?
(1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate has a molecular weight of 361.45 g/mol, XLogP of 4.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylpiperidin-4-yl) N-isoquinolin-5-ylcarbamate is sourced from PubChem (CID 58018309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).