About 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane
9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane (PubChem CID 58019084) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane |
| PubChem CID | 58019084 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane |
| SMILES | [C-]#[N+]C1(C)C2CSCC1CN(C)C2 |
| InChI | InChI=1S/C10H16N2S/c1-10(11-2)8-4-12(3)5-9(10)7-13-6-8/h8-9H,4-7H2,1,3H3 |
| InChIKey | GUNWURAUHWZGPU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane?
The IUPAC name of 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane (CID 58019084) is 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane.
What is the SMILES notation for 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane?
The canonical SMILES for 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane is [C-]#[N+]C1(C)C2CSCC1CN(C)C2.
What is the InChIKey of 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane?
The InChIKey is GUNWURAUHWZGPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S/c1-10(11-2)8-4-12(3)5-9(10)7-13-6-8/h8-9H,4-7H2,1,3H3.
What are the key properties of 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane?
9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane has a molecular weight of 196.32 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-isocyano-7,9-dimethyl-3-thia-7-azabicyclo[3.3.1]nonane is sourced from PubChem (CID 58019084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).