C28H50O3Si — CID 58019165
(3S)-1-[(2E)-2-[(7aR)-1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]bicyclo[3.1.0]hexan-3-ol (PubChem CID 58019165) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is (3S)-1-[(2E)-2-[(7aR)-1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]bicyclo[3.1.0]hexan-3-ol.
| Compound Name | (3S)-1-[(2E)-2-[(7aR)-1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]bicyclo[3.1.0]hexan-3-ol |
|---|---|
| PubChem CID | 58019165 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | (3S)-1-[(2E)-2-[(7aR)-1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]bicyclo[3.1.0]hexan-3-ol |
| SMILES | COC(/C=C1\CCC[C@@]2(C)C1CCC2[C@H](C)CO[Si](C)(C)C(C)(C)C)C12CC1C[C@H](O)C2 |
| InChI | InChI=1S/C28H50O3Si/c1-19(18-31-32(7,8)26(2,3)4)23-11-12-24-20(10-9-13-27(23,24)5)14-25(30-6)28-16-21(28)15-22(29)17-28/h14,19,21-25,29H,9-13,15-18H2,1-8H3/b20-14+/t19-,21?,22+,23?,24?,25?,27-,28?/m1/s1 |
| InChIKey | KFTLQXAZZFTCPR-CZLOOYQUSA-N |
| XLogP | 6.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|