C20H33O2S- — CID 58019203
(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfinate (PubChem CID 58019203) has the molecular formula C20H33O2S- and a molecular weight of 337.55 g/mol. Its IUPAC name is (6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfinate.
| Compound Name | (6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfinate |
|---|---|
| PubChem CID | 58019203 |
| Molecular Formula | C20H33O2S- |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfinate |
| SMILES | CC(C)=CCC/C(C)=C/CC(/C=C(\C)CCC=C(C)C)S(=O)[O-] |
| InChI | InChI=1S/C20H34O2S/c1-16(2)9-7-11-18(5)13-14-20(23(21)22)15-19(6)12-8-10-17(3)4/h9-10,13,15,20H,7-8,11-12,14H2,1-6H3,(H,21,22)/p-1/b18-13+,19-15+ |
| InChIKey | UQRLTEFOBZDNQJ-HQSZAHFGSA-M |
| XLogP | 6.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|