C27H45N4O2S+ — CID 58019302
3-methyl-N,N-bis[2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline (PubChem CID 58019302) has the molecular formula C27H45N4O2S+ and a molecular weight of 489.75 g/mol. Its IUPAC name is 3-methyl-N,N-bis[2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline.
| Compound Name | 3-methyl-N,N-bis[2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 58019302 |
| Molecular Formula | C27H45N4O2S+ |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | 3-methyl-N,N-bis[2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
| SMILES | Cc1cc(N(CC(C)COC(C)(C)C)CC(C)COC(C)(C)C)ccc1/N=N/c1scc[n+]1C |
| InChI | InChI=1S/C27H45N4O2S/c1-20(18-32-26(4,5)6)16-31(17-21(2)19-33-27(7,8)9)23-11-12-24(22(3)15-23)28-29-25-30(10)13-14-34-25/h11-15,20-21H,16-19H2,1-10H3/q+1 |
| InChIKey | REUMIDYEOWBKPV-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 50.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|