C19H29N4O3S2+ — CID 58019307
3-methyl-N,N-dipropyl-4-[[3-[3-(trioxidanylsulfanyl)propyl]-1,3-thiazol-3-ium-2-yl]diazenyl]aniline (PubChem CID 58019307) has the molecular formula C19H29N4O3S2+ and a molecular weight of 425.60 g/mol. Its IUPAC name is 3-methyl-N,N-dipropyl-4-[[3-[3-(trioxidanylsulfanyl)propyl]-1,3-thiazol-3-ium-2-yl]diazenyl]aniline.
| Compound Name | 3-methyl-N,N-dipropyl-4-[[3-[3-(trioxidanylsulfanyl)propyl]-1,3-thiazol-3-ium-2-yl]diazenyl]aniline |
|---|---|
| PubChem CID | 58019307 |
| Molecular Formula | C19H29N4O3S2+ |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3-methyl-N,N-dipropyl-4-[[3-[3-(trioxidanylsulfanyl)propyl]-1,3-thiazol-3-ium-2-yl]diazenyl]aniline |
| SMILES | CCCN(CCC)c1ccc(/N=N/c2scc[n+]2CCCSOOO)c(C)c1 |
| InChI | InChI=1S/C19H28N4O3S2/c1-4-9-22(10-5-2)17-7-8-18(16(3)15-17)20-21-19-23(12-14-27-19)11-6-13-28-26-25-24/h7-8,12,14-15H,4-6,9-11,13H2,1-3H3/p+1 |
| InChIKey | MUQHGIBBKSABER-UHFFFAOYSA-O |
| XLogP | 5.85 |
| TPSA | 70.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|