C32H21F3IrN6-2 — CID 58019500
7,10-dimethyl-3-phenyl-12H-phenanthro[9,10-b]pyrazin-12-ide;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine (PubChem CID 58019500) has the molecular formula C32H21F3IrN6-2 and a molecular weight of 738.77 g/mol. Its IUPAC name is 7,10-dimethyl-3-phenyl-12H-phenanthro[9,10-b]pyrazin-12-ide;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine.
| Compound Name | 7,10-dimethyl-3-phenyl-12H-phenanthro[9,10-b]pyrazin-12-ide;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine |
|---|---|
| PubChem CID | 58019500 |
| Molecular Formula | C32H21F3IrN6-2 |
| Molecular Weight | 738.77 g/mol |
| Exact Mass | 739.14 |
| IUPAC Name | 7,10-dimethyl-3-phenyl-12H-phenanthro[9,10-b]pyrazin-12-ide;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine |
| SMILES | Cc1c[c-]c2c(c1)c1cc(C)ccc1c1nc(-c3ccccc3)cnc21.FC(F)(F)c1n[n-]c(-c2ccccn2)n1.[Ir] |
| InChI | InChI=1S/C24H17N2.C8H4F3N4.Ir/c1-15-8-10-18-20(12-15)21-13-16(2)9-11-19(21)24-23(18)25-14-22(26-24)17-6-4-3-5-7-17;9-8(10,11)7-13-6(14-15-7)5-3-1-2-4-12-5;/h3-9,11-14H,1-2H3;1-4H;/q2*-1; |
| InChIKey | NRRRIMLONZQCNM-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 78.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.77 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|