C34H25F3IrN6-2 — CID 58019503
3-(4-tert-butylphenyl)-12H-phenanthro[9,10-b]pyrazin-12-ide;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine (PubChem CID 58019503) has the molecular formula C34H25F3IrN6-2 and a molecular weight of 766.83 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-12H-phenanthro[9,10-b]pyrazin-12-ide;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine.
| Compound Name | 3-(4-tert-butylphenyl)-12H-phenanthro[9,10-b]pyrazin-12-ide;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine |
|---|---|
| PubChem CID | 58019503 |
| Molecular Formula | C34H25F3IrN6-2 |
| Molecular Weight | 766.83 g/mol |
| Exact Mass | 767.17 |
| IUPAC Name | 3-(4-tert-butylphenyl)-12H-phenanthro[9,10-b]pyrazin-12-ide;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine |
| SMILES | CC(C)(C)c1ccc(-c2cnc3c4[c-]cccc4c4ccccc4c3n2)cc1.FC(F)(F)c1n[n-]c(-c2ccccn2)n1.[Ir] |
| InChI | InChI=1S/C26H21N2.C8H4F3N4.Ir/c1-26(2,3)18-14-12-17(13-15-18)23-16-27-24-21-10-6-4-8-19(21)20-9-5-7-11-22(20)25(24)28-23;9-8(10,11)7-13-6(14-15-7)5-3-1-2-4-12-5;/h4-9,11-16H,1-3H3;1-4H;/q2*-1; |
| InChIKey | POLRBHWTSPOYOM-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 78.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.83 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|