About 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone
1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone (PubChem CID 58019840) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone |
| PubChem CID | 58019840 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone |
| SMILES | CC(=O)C12CC1C(CO)C(C)N2C |
| InChI | InChI=1S/C10H17NO2/c1-6-8(5-12)9-4-10(9,7(2)13)11(6)3/h6,8-9,12H,4-5H2,1-3H3 |
| InChIKey | IQKJTIOXGCNNLN-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone?
The IUPAC name of 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone (CID 58019840) is 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone.
What is the SMILES notation for 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone?
The canonical SMILES for 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone is CC(=O)C12CC1C(CO)C(C)N2C.
What is the InChIKey of 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone?
The InChIKey is IQKJTIOXGCNNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-6-8(5-12)9-4-10(9,7(2)13)11(6)3/h6,8-9,12H,4-5H2,1-3H3.
What are the key properties of 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone?
1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone has a molecular weight of 183.25 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(hydroxymethyl)-2,3-dimethyl-2-azabicyclo[3.1.0]hexan-1-yl]ethanone is sourced from PubChem (CID 58019840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).