About 5-bromo-1H-pyrimidine-2,4-dione
5-bromo-1H-pyrimidine-2,4-dione (PubChem CID 5802) has the molecular formula C4H3BrN2O2
and a molecular weight of 190.98 g/mol. Its IUPAC name is 5-bromo-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-bromo-1H-pyrimidine-2,4-dione |
| PubChem CID | 5802 |
| Molecular Formula | C4H3BrN2O2 |
| Molecular Weight | 190.98 g/mol |
| Exact Mass | 189.94 |
| IUPAC Name | 5-bromo-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(Br)c(=O)[nH]1 |
| InChI | InChI=1S/C4H3BrN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| InChIKey | LQLQRFGHAALLLE-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.98 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-bromo-1H-pyrimidine-2,4-dione (CID 5802) is 5-bromo-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-bromo-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-bromo-1H-pyrimidine-2,4-dione is O=c1[nH]cc(Br)c(=O)[nH]1.
What is the InChIKey of 5-bromo-1H-pyrimidine-2,4-dione?
The InChIKey is LQLQRFGHAALLLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3BrN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9).
What are the key properties of 5-bromo-1H-pyrimidine-2,4-dione?
5-bromo-1H-pyrimidine-2,4-dione has a molecular weight of 190.98 g/mol, XLogP of -0.17, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 5802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).