C21H20F3N3O3 — CID 58020322
4-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]-3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazole (PubChem CID 58020322) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is 4-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]-3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazole.
| Compound Name | 4-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]-3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazole |
|---|---|
| PubChem CID | 58020322 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]-3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazole |
| SMILES | COc1ccc(Cc2c(C)nn(CC(F)(F)F)c2C)cc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20F3N3O3/c1-13-18(14(2)26(25-13)12-21(22,23)24)9-15-7-8-20(30-3)19(10-15)16-5-4-6-17(11-16)27(28)29/h4-8,10-11H,9,12H2,1-3H3 |
| InChIKey | ICOFSNFHADYWFF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|