C23H30N2 — CID 58020443
N-(1-adamantylmethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 58020443) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-(1-adamantylmethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 58020443 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N-(1-adamantylmethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | c1ccc2c3c([nH]c2c1)C(NCC12CC4CC(CC(C4)C1)C2)CCC3 |
| InChI | InChI=1S/C23H30N2/c1-2-6-20-18(4-1)19-5-3-7-21(22(19)25-20)24-14-23-11-15-8-16(12-23)10-17(9-15)13-23/h1-2,4,6,15-17,21,24-25H,3,5,7-14H2 |
| InChIKey | XXJBJLQVQIVVMV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|