C27H27F3N2O4S — CID 58020947
ethyl 4-[[5-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]-2,3-dihydroindole-1-carbonyl]amino]butanoate (PubChem CID 58020947) has the molecular formula C27H27F3N2O4S and a molecular weight of 532.58 g/mol. Its IUPAC name is ethyl 4-[[5-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]-2,3-dihydroindole-1-carbonyl]amino]butanoate.
| Compound Name | ethyl 4-[[5-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]-2,3-dihydroindole-1-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 58020947 |
| Molecular Formula | C27H27F3N2O4S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | ethyl 4-[[5-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]-2,3-dihydroindole-1-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)N1CCc2cc(OCc3cc(-c4ccccc4)c(C(F)(F)F)s3)ccc21 |
| InChI | InChI=1S/C27H27F3N2O4S/c1-2-35-24(33)9-6-13-31-26(34)32-14-12-19-15-20(10-11-23(19)32)36-17-21-16-22(18-7-4-3-5-8-18)25(37-21)27(28,29)30/h3-5,7-8,10-11,15-16H,2,6,9,12-14,17H2,1H3,(H,31,34) |
| InChIKey | KFTIDNAOMQZVRS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|