About [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate
[3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate (PubChem CID 58021553) has the molecular formula C22H20O4
and a molecular weight of 348.40 g/mol. Its IUPAC name is [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate.
Molecular Properties
| Compound Name | [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate |
| PubChem CID | 58021553 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COC1=CC=C2C=CC3=C4C(=CC=C1C24)C=CC3 |
| InChI | InChI=1S/C22H20O4/c1-2-20(24)26-13-17(23)12-25-19-11-9-16-7-6-14-4-3-5-15-8-10-18(19)22(16)21(14)15/h2-3,5-11,17,22-23H,1,4,12-13H2 |
| InChIKey | MQCWUPMUHPSQHK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate?
The IUPAC name of [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate (CID 58021553) is [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate.
What is the SMILES notation for [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate?
The canonical SMILES for [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate is C=CC(=O)OCC(O)COC1=CC=C2C=CC3=C4C(=CC=C1C24)C=CC3.
What is the InChIKey of [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate?
The InChIKey is MQCWUPMUHPSQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O4/c1-2-20(24)26-13-17(23)12-25-19-11-9-16-7-6-14-4-3-5-15-8-10-18(19)22(16)21(14)15/h2-3,5-11,17,22-23H,1,4,12-13H2.
What are the key properties of [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate?
[3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate has a molecular weight of 348.40 g/mol, XLogP of 3.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6,10b-dihydropyren-1-yloxy)-2-hydroxypropyl] prop-2-enoate is sourced from PubChem (CID 58021553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).