C15H22F2O5S — CID 58021599
2-[(3,5-dimethyl-1-adamantyl)methoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 58021599) has the molecular formula C15H22F2O5S and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1-adamantyl)methoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[(3,5-dimethyl-1-adamantyl)methoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 58021599 |
| Molecular Formula | C15H22F2O5S |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-[(3,5-dimethyl-1-adamantyl)methoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CC12CC3CC(C)(C1)CC(COC(=O)C(F)(F)S(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C15H22F2O5S/c1-12-3-10-4-13(2,6-12)8-14(5-10,7-12)9-22-11(18)15(16,17)23(19,20)21/h10H,3-9H2,1-2H3,(H,19,20,21) |
| InChIKey | DIJGTYKZRAYXLG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|