About 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene
5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 58021687) has the molecular formula C9H12F2O3S
and a molecular weight of 238.25 g/mol. Its IUPAC name is 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene |
| PubChem CID | 58021687 |
| Molecular Formula | C9H12F2O3S |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | OOOSC(F)(F)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C9H12F2O3S/c10-9(11,15-14-13-12)5-8-4-6-1-2-7(8)3-6/h1-2,6-8,12H,3-5H2 |
| InChIKey | UJXSYWHCIOAHQS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene?
The IUPAC name of 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene (CID 58021687) is 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene is OOOSC(F)(F)CC1CC2C=CC1C2.
What is the InChIKey of 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene?
The InChIKey is UJXSYWHCIOAHQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2O3S/c10-9(11,15-14-13-12)5-8-4-6-1-2-7(8)3-6/h1-2,6-8,12H,3-5H2.
What are the key properties of 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene?
5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene has a molecular weight of 238.25 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 58021687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).