C9H10F4O3S — CID 58021731
5-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 58021731) has the molecular formula C9H10F4O3S and a molecular weight of 274.24 g/mol. Its IUPAC name is 5-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 58021731 |
| Molecular Formula | C9H10F4O3S |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 5-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | OOOSC(F)(F)C(F)(F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C9H10F4O3S/c10-8(11,9(12,13)17-16-15-14)7-4-5-1-2-6(7)3-5/h1-2,5-7,14H,3-4H2 |
| InChIKey | IQXRUWJKVUNWDA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|