C22H30O2 — CID 58021819
(6S)-3-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 58021819) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (6S)-3-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | (6S)-3-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 58021819 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (6S)-3-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(=O)[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C22H30O2/c1-7-8-10-16(2)11-9-12-17(3)13-14-19-18(4)21(24)20(23)15-22(19,5)6/h7-14,20,23H,15H2,1-6H3/b8-7+,11-9+,14-13+,16-10+,17-12+/t20-/m0/s1 |
| InChIKey | NYBIPLKEXZILGL-SMJRZCQRSA-N |
| XLogP | 5.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|