C33H32N4O5 — CID 58021836
23-(furan-2-ylmethyl)-17,20-dioxa-4,14,23,26-tetrazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione (PubChem CID 58021836) has the molecular formula C33H32N4O5 and a molecular weight of 564.64 g/mol. Its IUPAC name is 23-(furan-2-ylmethyl)-17,20-dioxa-4,14,23,26-tetrazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione.
| Compound Name | 23-(furan-2-ylmethyl)-17,20-dioxa-4,14,23,26-tetrazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione |
|---|---|
| PubChem CID | 58021836 |
| Molecular Formula | C33H32N4O5 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 23-(furan-2-ylmethyl)-17,20-dioxa-4,14,23,26-tetrazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione |
| SMILES | O=C1NC(=O)C2=C1c1cn(c3ccccc13)CCOCCOCCN(Cc1ccco1)CCn1cc2c2ccccc21 |
| InChI | InChI=1S/C33H32N4O5/c38-32-30-26-21-36(28-9-3-1-7-24(26)28)12-11-35(20-23-6-5-15-42-23)13-16-40-18-19-41-17-14-37-22-27(31(30)33(39)34-32)25-8-2-4-10-29(25)37/h1-10,15,21-22H,11-14,16-20H2,(H,34,38,39) |
| InChIKey | CLYOTMAKILCBND-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|