C8H10O4 — CID 58021910
(3aS,6aR)-5-methoxy-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1,3-dione (PubChem CID 58021910) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is (3aS,6aR)-5-methoxy-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1,3-dione.
| Compound Name | (3aS,6aR)-5-methoxy-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1,3-dione |
|---|---|
| PubChem CID | 58021910 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (3aS,6aR)-5-methoxy-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1,3-dione |
| SMILES | COC1C[C@@H]2C(=O)OC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C8H10O4/c1-11-4-2-5-6(3-4)8(10)12-7(5)9/h4-6H,2-3H2,1H3/t4?,5-,6+ |
| InChIKey | KBJHZVDLPOFNJR-GOHHTPAQSA-N |
| XLogP | 0.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|