About [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium
[(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium (PubChem CID 58021940) has the molecular formula C7H8OWY-2
and a molecular weight of 380.89 g/mol. Its IUPAC name is [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium.
Molecular Properties
| Compound Name | [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium |
| PubChem CID | 58021940 |
| Molecular Formula | C7H8OWY-2 |
| Molecular Weight | 380.89 g/mol |
| Exact Mass | 380.92 |
| IUPAC Name | [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium |
| SMILES | [H]/[C-]=C/C(C[CH2-])=C(/O)C=[W].[Y] |
| InChI | InChI=1S/C7H8O.W.Y/c1-4-7(5-2)6(3)8;;/h1,3-4,8H,2,5H2;;/q-2;;/b7-6-;; |
| InChIKey | FBSWLHZSRWISLI-AQTVDGORSA-N |
| XLogP | 1.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.89 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium?
The IUPAC name of [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium (CID 58021940) is [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium.
What is the SMILES notation for [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium?
The canonical SMILES for [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium is [H]/[C-]=C/C(C[CH2-])=C(/O)C=[W].[Y].
What is the InChIKey of [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium?
The InChIKey is FBSWLHZSRWISLI-AQTVDGORSA-N. The full InChI is InChI=1S/C7H8O.W.Y/c1-4-7(5-2)6(3)8;;/h1,3-4,8H,2,5H2;;/q-2;;/b7-6-;;.
What are the key properties of [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium?
[(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium has a molecular weight of 380.89 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-3-ethyl-2-hydroxypenta-2,4-dienylidene]tungsten;yttrium is sourced from PubChem (CID 58021940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).