C25H33N5O2 — CID 58022463
tert-butyl N-[[3-[[(3S)-3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]phenyl]methyl]carbamate (PubChem CID 58022463) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is tert-butyl N-[[3-[[(3S)-3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[(3S)-3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 58022463 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | tert-butyl N-[[3-[[(3S)-3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(CN2CCC[C@H](Nc3ccc4[nH]ncc4c3)C2)c1 |
| InChI | InChI=1S/C25H33N5O2/c1-25(2,3)32-24(31)26-14-18-6-4-7-19(12-18)16-30-11-5-8-22(17-30)28-21-9-10-23-20(13-21)15-27-29-23/h4,6-7,9-10,12-13,15,22,28H,5,8,11,14,16-17H2,1-3H3,(H,26,31)(H,27,29)/t22-/m0/s1 |
| InChIKey | YMLDXRSLJHAWSZ-QFIPXVFZSA-N |
| XLogP | 4.66 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |