About CID 58022648
CID 58022648 (PubChem CID 58022648) has the molecular formula C14H35O2Si3
and a molecular weight of 319.69 g/mol.
Molecular Properties
| Compound Name | CID 58022648 |
| PubChem CID | 58022648 |
| Molecular Formula | C14H35O2Si3 |
| Molecular Weight | 319.69 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | — |
| SMILES | CCCC[Si](C)(O[Si](C)(C)C)C(C)(C)OC[Si](C)C |
| InChI | InChI=1S/C14H35O2Si3/c1-10-11-12-19(9,16-18(6,7)8)14(2,3)15-13-17(4)5/h10-13H2,1-9H3 |
| InChIKey | LYRVPYBMBPRZIT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58022648 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58022648?
The IUPAC name of CID 58022648 (CID 58022648) is not available.
What is the SMILES notation for CID 58022648?
The canonical SMILES for CID 58022648 is CCCC[Si](C)(O[Si](C)(C)C)C(C)(C)OC[Si](C)C.
What is the InChIKey of CID 58022648?
The InChIKey is LYRVPYBMBPRZIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H35O2Si3/c1-10-11-12-19(9,16-18(6,7)8)14(2,3)15-13-17(4)5/h10-13H2,1-9H3.
What are the key properties of CID 58022648?
CID 58022648 has a molecular weight of 319.69 g/mol, XLogP of 4.84, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58022648 is sourced from PubChem (CID 58022648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).