About 4-azatricyclo[4.3.1.13,8]undecan-9-ol
4-azatricyclo[4.3.1.13,8]undecan-9-ol (PubChem CID 58023127) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 4-azatricyclo[4.3.1.13,8]undecan-9-ol.
Molecular Properties
| Compound Name | 4-azatricyclo[4.3.1.13,8]undecan-9-ol |
| PubChem CID | 58023127 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4-azatricyclo[4.3.1.13,8]undecan-9-ol |
| SMILES | OC1C2CC3CNC(C2)CC1C3 |
| InChI | InChI=1S/C10H17NO/c12-10-7-1-6-2-8(10)4-9(3-7)11-5-6/h6-12H,1-5H2 |
| InChIKey | PHXJZRUGAQGVQX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-azatricyclo[4.3.1.13,8]undecan-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[4.3.1.13,8]undecan-9-ol?
The IUPAC name of 4-azatricyclo[4.3.1.13,8]undecan-9-ol (CID 58023127) is 4-azatricyclo[4.3.1.13,8]undecan-9-ol.
What is the SMILES notation for 4-azatricyclo[4.3.1.13,8]undecan-9-ol?
The canonical SMILES for 4-azatricyclo[4.3.1.13,8]undecan-9-ol is OC1C2CC3CNC(C2)CC1C3.
What is the InChIKey of 4-azatricyclo[4.3.1.13,8]undecan-9-ol?
The InChIKey is PHXJZRUGAQGVQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c12-10-7-1-6-2-8(10)4-9(3-7)11-5-6/h6-12H,1-5H2.
What are the key properties of 4-azatricyclo[4.3.1.13,8]undecan-9-ol?
4-azatricyclo[4.3.1.13,8]undecan-9-ol has a molecular weight of 167.25 g/mol, XLogP of 0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[4.3.1.13,8]undecan-9-ol is sourced from PubChem (CID 58023127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).