C25H27FN3O+ — CID 58023219
N-(1-adamantyl)-1-(2-fluoro-4-methylphenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58023219) has the molecular formula C25H27FN3O+ and a molecular weight of 404.51 g/mol. Its IUPAC name is N-(1-adamantyl)-1-(2-fluoro-4-methylphenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | N-(1-adamantyl)-1-(2-fluoro-4-methylphenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58023219 |
| Molecular Formula | C25H27FN3O+ |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-(1-adamantyl)-1-(2-fluoro-4-methylphenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | Cc1ccc(-c2[nH]c(C(=O)NC34CC5CC(CC(C5)C3)C4)[n+]3ccccc23)c(F)c1 |
| InChI | InChI=1S/C25H26FN3O/c1-15-5-6-19(20(26)8-15)22-21-4-2-3-7-29(21)23(27-22)24(30)28-25-12-16-9-17(13-25)11-18(10-16)14-25/h2-8,16-18H,9-14H2,1H3,(H,28,30)/p+1 |
| InChIKey | JUUORTUCKUYQNP-UHFFFAOYSA-O |
| XLogP | 4.57 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|