C17H26N4O2+2 — CID 58023287
N-(2,2-dimethylpropyl)-3-morpholin-4-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide (PubChem CID 58023287) has the molecular formula C17H26N4O2+2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-3-morpholin-4-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide.
| Compound Name | N-(2,2-dimethylpropyl)-3-morpholin-4-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 58023287 |
| Molecular Formula | C17H26N4O2+2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | N-(2,2-dimethylpropyl)-3-morpholin-4-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
| SMILES | CC(C)(C)CNC(=O)c1[nH]c([NH+]2CCOCC2)[n+]2ccccc12 |
| InChI | InChI=1S/C17H24N4O2/c1-17(2,3)12-18-15(22)14-13-6-4-5-7-21(13)16(19-14)20-8-10-23-11-9-20/h4-7H,8-12H2,1-3H3,(H,18,22)/p+2 |
| InChIKey | QXDVEOSYNCZNLR-UHFFFAOYSA-P |
| XLogP | 0.08 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|