C21H26N3O+ — CID 58023528
N-(1-adamantyl)-3-cyclopropyl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide (PubChem CID 58023528) has the molecular formula C21H26N3O+ and a molecular weight of 336.46 g/mol. Its IUPAC name is N-(1-adamantyl)-3-cyclopropyl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide.
| Compound Name | N-(1-adamantyl)-3-cyclopropyl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 58023528 |
| Molecular Formula | C21H26N3O+ |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | N-(1-adamantyl)-3-cyclopropyl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1[nH]c(C2CC2)[n+]2ccccc12 |
| InChI | InChI=1S/C21H25N3O/c25-20(23-21-10-13-7-14(11-21)9-15(8-13)12-21)18-17-3-1-2-6-24(17)19(22-18)16-4-5-16/h1-3,6,13-16H,4-5,7-12H2,(H,23,25)/p+1 |
| InChIKey | XXXVUPREGXUDTE-UHFFFAOYSA-O |
| XLogP | 3.33 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|