C16H22N3O2+ — CID 58023786
3-cyclopropyl-N-(3-hydroxy-2,2-dimethylpropyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide (PubChem CID 58023786) has the molecular formula C16H22N3O2+ and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-cyclopropyl-N-(3-hydroxy-2,2-dimethylpropyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide.
| Compound Name | 3-cyclopropyl-N-(3-hydroxy-2,2-dimethylpropyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 58023786 |
| Molecular Formula | C16H22N3O2+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 3-cyclopropyl-N-(3-hydroxy-2,2-dimethylpropyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
| SMILES | CC(C)(CO)CNC(=O)c1[nH]c(C2CC2)[n+]2ccccc12 |
| InChI | InChI=1S/C16H21N3O2/c1-16(2,10-20)9-17-15(21)13-12-5-3-4-8-19(12)14(18-13)11-6-7-11/h3-5,8,11,20H,6-7,9-10H2,1-2H3,(H,17,21)/p+1 |
| InChIKey | NRWARMISTKLDDJ-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|