C21H23FN3O2+ — CID 58023960
N-(2,2-dimethyloxan-4-yl)-1-(4-fluorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58023960) has the molecular formula C21H23FN3O2+ and a molecular weight of 368.43 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-1-(4-fluorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-1-(4-fluorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58023960 |
| Molecular Formula | C21H23FN3O2+ |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-1-(4-fluorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2[nH]c(-c3ccc(F)cc3)c3cccc[n+]23)CCO1 |
| InChI | InChI=1S/C21H22FN3O2/c1-21(2)13-16(10-12-27-21)23-20(26)19-24-18(14-6-8-15(22)9-7-14)17-5-3-4-11-25(17)19/h3-9,11,16H,10,12-13H2,1-2H3,(H,23,26)/p+1 |
| InChIKey | VPSJKYFQNSVOJW-UHFFFAOYSA-O |
| XLogP | 3.25 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|