C14H26N4O3 — CID 58024990
tert-butyl N-[(3R)-1-[[(3R)-pyrrolidin-3-yl]carbamoyl]pyrrolidin-3-yl]carbamate (PubChem CID 58024990) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[[(3R)-pyrrolidin-3-yl]carbamoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[[(3R)-pyrrolidin-3-yl]carbamoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 58024990 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | tert-butyl N-[(3R)-1-[[(3R)-pyrrolidin-3-yl]carbamoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(C(=O)N[C@@H]2CCNC2)C1 |
| InChI | InChI=1S/C14H26N4O3/c1-14(2,3)21-13(20)17-11-5-7-18(9-11)12(19)16-10-4-6-15-8-10/h10-11,15H,4-9H2,1-3H3,(H,16,19)(H,17,20)/t10-,11-/m1/s1 |
| InChIKey | ONNIUXBNGLXCDT-GHMZBOCLSA-N |
| XLogP | 0.66 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |