C29H33N3O7 — CID 58025135
[(2S,3S,13S,15R)-15-cyano-13-ethyl-3,22-dihydroxy-21-methoxy-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate (PubChem CID 58025135) has the molecular formula C29H33N3O7 and a molecular weight of 535.60 g/mol. Its IUPAC name is [(2S,3S,13S,15R)-15-cyano-13-ethyl-3,22-dihydroxy-21-methoxy-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate.
| Compound Name | [(2S,3S,13S,15R)-15-cyano-13-ethyl-3,22-dihydroxy-21-methoxy-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate |
|---|---|
| PubChem CID | 58025135 |
| Molecular Formula | C29H33N3O7 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | [(2S,3S,13S,15R)-15-cyano-13-ethyl-3,22-dihydroxy-21-methoxy-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate |
| SMILES | CC[C@H]1c2c3c(c(C)c(OC(C)=O)c2[C@H](O)[C@@H]2C4c5c(cc(C)c(OC)c5O)CC([C@H](C#N)N12)N4C)OCO3 |
| InChI | InChI=1S/C29H33N3O7/c1-7-16-20-21(27(39-14(4)33)13(3)28-29(20)38-11-37-28)24(34)23-22-19-15(8-12(2)26(36-6)25(19)35)9-17(31(22)5)18(10-30)32(16)23/h8,16-18,22-24,34-35H,7,9,11H2,1-6H3/t16-,17?,18-,22?,23-,24-/m0/s1 |
| InChIKey | XGKLNKZXYBAOKA-WCANVRNSSA-N |
| XLogP | 3.34 |
| TPSA | 124.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|