C23H34O3 — CID 58025200
(E)-1-[(1'R,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-5,5-dideuterio-4-methyloct-1-en-6-yn-3-one (PubChem CID 58025200) has the molecular formula C23H34O3 and a molecular weight of 360.53 g/mol. Its IUPAC name is (E)-1-[(1'R,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-5,5-dideuterio-4-methyloct-1-en-6-yn-3-one.
| Compound Name | (E)-1-[(1'R,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-5,5-dideuterio-4-methyloct-1-en-6-yn-3-one |
|---|---|
| PubChem CID | 58025200 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (E)-1-[(1'R,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-5,5-dideuterio-4-methyloct-1-en-6-yn-3-one |
| SMILES | [2H]C([2H])(C#CC)C(C)C(=O)/C=C/[C@@H]1[C@H]2CC3(C[C@H]2C[C@H]1C)OCC(C)(C)CO3 |
| InChI | InChI=1S/C23H34O3/c1-6-7-8-16(2)21(24)10-9-19-17(3)11-18-12-23(13-20(18)19)25-14-22(4,5)15-26-23/h9-10,16-20H,8,11-15H2,1-5H3/b10-9+/t16?,17-,18-,19+,20+/m1/s1/i8D2 |
| InChIKey | FQLCQWYUKHWKFS-QGZUAACTSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|