C15H24O3 — CID 58025206
(1'S,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde (PubChem CID 58025206) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1'S,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde.
| Compound Name | (1'S,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde |
|---|---|
| PubChem CID | 58025206 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1'S,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde |
| SMILES | C[C@@H]1C[C@@H]2CC3(C[C@@H]2[C@H]1C=O)OCC(C)(C)CO3 |
| InChI | InChI=1S/C15H24O3/c1-10-4-11-5-15(6-12(11)13(10)7-16)17-8-14(2,3)9-18-15/h7,10-13H,4-6,8-9H2,1-3H3/t10-,11-,12+,13+/m1/s1 |
| InChIKey | DHCMTUUJVLVWET-NDBYEHHHSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|