C30H52O4Si — CID 58025211
(E,3R)-1-[(1'R,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4,5,5-trimethyloct-1-en-6-yn-3-ol (PubChem CID 58025211) has the molecular formula C30H52O4Si and a molecular weight of 504.83 g/mol. Its IUPAC name is (E,3R)-1-[(1'R,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4,5,5-trimethyloct-1-en-6-yn-3-ol.
| Compound Name | (E,3R)-1-[(1'R,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4,5,5-trimethyloct-1-en-6-yn-3-ol |
|---|---|
| PubChem CID | 58025211 |
| Molecular Formula | C30H52O4Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | (E,3R)-1-[(1'R,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4,5,5-trimethyloct-1-en-6-yn-3-ol |
| SMILES | CC#CC(C)(C)C(C)[C@H](O)/C=C/[C@@H]1[C@H]2CC3(C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)OCC(C)(C)CO3 |
| InChI | InChI=1S/C30H52O4Si/c1-12-15-29(8,9)21(2)25(31)14-13-23-24-18-30(32-19-28(6,7)20-33-30)17-22(24)16-26(23)34-35(10,11)27(3,4)5/h13-14,21-26,31H,16-20H2,1-11H3/b14-13+/t21?,22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | MRNQRJNNTPOUDB-LFXBUIMJSA-N |
| XLogP | 6.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|