C25H38O3 — CID 58025223
(E)-1-[(1'R,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4,5,5-trimethyloct-1-en-6-yn-3-one (PubChem CID 58025223) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (E)-1-[(1'R,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4,5,5-trimethyloct-1-en-6-yn-3-one.
| Compound Name | (E)-1-[(1'R,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4,5,5-trimethyloct-1-en-6-yn-3-one |
|---|---|
| PubChem CID | 58025223 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (E)-1-[(1'R,2'R,3'aR,6'aS)-2',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4,5,5-trimethyloct-1-en-6-yn-3-one |
| SMILES | CC#CC(C)(C)C(C)C(=O)/C=C/[C@@H]1[C@H]2CC3(C[C@H]2C[C@H]1C)OCC(C)(C)CO3 |
| InChI | InChI=1S/C25H38O3/c1-8-11-24(6,7)18(3)22(26)10-9-20-17(2)12-19-13-25(14-21(19)20)27-15-23(4,5)16-28-25/h9-10,17-21H,12-16H2,1-7H3/b10-9+/t17-,18?,19-,20+,21+/m1/s1 |
| InChIKey | HPWATDYOMFOXGZ-PDXWRJIWSA-N |
| XLogP | 5.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|