C21H38O4Si — CID 58025245
1-[(1'R,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]ethanone (PubChem CID 58025245) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is 1-[(1'R,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]ethanone.
| Compound Name | 1-[(1'R,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]ethanone |
|---|---|
| PubChem CID | 58025245 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 1-[(1'R,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@H]2CC3(C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)OCC(C)(C)CO3 |
| InChI | InChI=1S/C21H38O4Si/c1-14(22)18-16-11-21(23-12-20(5,6)13-24-21)10-15(16)9-17(18)25-26(7,8)19(2,3)4/h15-18H,9-13H2,1-8H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | GYPVLNHRTXOCQH-XMTFNYHQSA-N |
| XLogP | 4.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|