C12H12BrF3O — CID 58026165
4-(2-bromophenyl)-1,1,1-trifluoro-4-methylpentan-2-one (PubChem CID 58026165) has the molecular formula C12H12BrF3O and a molecular weight of 309.12 g/mol. Its IUPAC name is 4-(2-bromophenyl)-1,1,1-trifluoro-4-methylpentan-2-one.
| Compound Name | 4-(2-bromophenyl)-1,1,1-trifluoro-4-methylpentan-2-one |
|---|---|
| PubChem CID | 58026165 |
| Molecular Formula | C12H12BrF3O |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 4-(2-bromophenyl)-1,1,1-trifluoro-4-methylpentan-2-one |
| SMILES | CC(C)(CC(=O)C(F)(F)F)c1ccccc1Br |
| InChI | InChI=1S/C12H12BrF3O/c1-11(2,7-10(17)12(14,15)16)8-5-3-4-6-9(8)13/h3-6H,7H2,1-2H3 |
| InChIKey | ISPJIBBIDXIXEG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |