About N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide
N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide (PubChem CID 580266) has the molecular formula C16H15N3O7
and a molecular weight of 361.31 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide.
Molecular Properties
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide |
| PubChem CID | 580266 |
| Molecular Formula | C16H15N3O7 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide |
| SMILES | COc1ccccc1OCCNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N3O7/c1-25-14-4-2-3-5-15(14)26-7-6-17-16(20)11-8-12(18(21)22)10-13(9-11)19(23)24/h2-5,8-10H,6-7H2,1H3,(H,17,20) |
| InChIKey | ZGEFDHUCXNOQCG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide?
The IUPAC name of N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide (CID 580266) is N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide.
What is the SMILES notation for N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide?
The canonical SMILES for N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide is COc1ccccc1OCCNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.
What is the InChIKey of N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide?
The InChIKey is ZGEFDHUCXNOQCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O7/c1-25-14-4-2-3-5-15(14)26-7-6-17-16(20)11-8-12(18(21)22)10-13(9-11)19(23)24/h2-5,8-10H,6-7H2,1H3,(H,17,20).
What are the key properties of N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide?
N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide has a molecular weight of 361.31 g/mol, XLogP of 2.32, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide is sourced from PubChem (CID 580266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).