C21H18N8O2 — CID 58026641
N-[4-[(4,5-dihydro-1H-imidazol-2-ylamino)carbamoyl]-1H-benzimidazol-2-yl]isoquinoline-3-carboxamide (PubChem CID 58026641) has the molecular formula C21H18N8O2 and a molecular weight of 414.43 g/mol. Its IUPAC name is N-[4-[(4,5-dihydro-1H-imidazol-2-ylamino)carbamoyl]-1H-benzimidazol-2-yl]isoquinoline-3-carboxamide.
| Compound Name | N-[4-[(4,5-dihydro-1H-imidazol-2-ylamino)carbamoyl]-1H-benzimidazol-2-yl]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 58026641 |
| Molecular Formula | C21H18N8O2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-[4-[(4,5-dihydro-1H-imidazol-2-ylamino)carbamoyl]-1H-benzimidazol-2-yl]isoquinoline-3-carboxamide |
| SMILES | O=C(Nc1nc2c(C(=O)NNC3=NCCN3)cccc2[nH]1)c1cc2ccccc2cn1 |
| InChI | InChI=1S/C21H18N8O2/c30-18(28-29-20-22-8-9-23-20)14-6-3-7-15-17(14)26-21(25-15)27-19(31)16-10-12-4-1-2-5-13(12)11-24-16/h1-7,10-11H,8-9H2,(H,28,30)(H2,22,23,29)(H2,25,26,27,31) |
| InChIKey | WWMGFKYYMWXBGR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|