C19H16N2O3S — CID 58026715
5-[(2-oxo-1-phenyl-3,4-dihydroquinolin-5-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 58026715) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 5-[(2-oxo-1-phenyl-3,4-dihydroquinolin-5-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(2-oxo-1-phenyl-3,4-dihydroquinolin-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58026715 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 5-[(2-oxo-1-phenyl-3,4-dihydroquinolin-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2cccc3c2CCC(=O)N3c2ccccc2)S1 |
| InChI | InChI=1S/C19H16N2O3S/c22-17-10-9-14-12(11-16-18(23)20-19(24)25-16)5-4-8-15(14)21(17)13-6-2-1-3-7-13/h1-8,16H,9-11H2,(H,20,23,24) |
| InChIKey | YISFMQUPFMQQCV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|