C20H18FNO3 — CID 58026843
8-fluoro-11-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-one (PubChem CID 58026843) has the molecular formula C20H18FNO3 and a molecular weight of 339.37 g/mol. Its IUPAC name is 8-fluoro-11-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-one.
| Compound Name | 8-fluoro-11-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-one |
|---|---|
| PubChem CID | 58026843 |
| Molecular Formula | C20H18FNO3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 8-fluoro-11-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-one |
| SMILES | COc1cc2c(c3c(=O)oc4cc(F)ccc4c13)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C20H18FNO3/c1-10-9-20(2,3)22-13-8-15(24-4)17-12-6-5-11(21)7-14(12)25-19(23)18(17)16(10)13/h5-9,22H,1-4H3 |
| InChIKey | BRVMPIPUKLSWME-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|